C21H29N5O4S — CID 164976559
10-[[9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(methylsulfanylmethyl)oxolan-2-yl]purin-6-yl]amino]dec-1-yn-5-one (PubChem CID 164976559) has the molecular formula C21H29N5O4S and a molecular weight of 447.56 g/mol. Its IUPAC name is 10-[[9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(methylsulfanylmethyl)oxolan-2-yl]purin-6-yl]amino]dec-1-yn-5-one.
| Compound Name | 10-[[9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(methylsulfanylmethyl)oxolan-2-yl]purin-6-yl]amino]dec-1-yn-5-one |
|---|---|
| PubChem CID | 164976559 |
| Molecular Formula | C21H29N5O4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 10-[[9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(methylsulfanylmethyl)oxolan-2-yl]purin-6-yl]amino]dec-1-yn-5-one |
| SMILES | C#CCCC(=O)CCCCCNc1ncnc2c1ncn2[C@@H]1O[C@H](CSC)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H29N5O4S/c1-3-4-8-14(27)9-6-5-7-10-22-19-16-20(24-12-23-19)26(13-25-16)21-18(29)17(28)15(30-21)11-31-2/h1,12-13,15,17-18,21,28-29H,4-11H2,2H3,(H,22,23,24)/t15-,17-,18-,21-/m1/s1 |
| InChIKey | DWGSFGDCSCRXJY-QTQZEZTPSA-N |
| XLogP | 1.76 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|