C15H24N5O6PS — CID 139373200
[(2R,3S,5R)-5-[6-(ethylamino)-2-propylsulfanylpurin-9-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 139373200) has the molecular formula C15H24N5O6PS and a molecular weight of 433.43 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[6-(ethylamino)-2-propylsulfanylpurin-9-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-[6-(ethylamino)-2-propylsulfanylpurin-9-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 139373200 |
| Molecular Formula | C15H24N5O6PS |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | [(2R,3S,5R)-5-[6-(ethylamino)-2-propylsulfanylpurin-9-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CCCSc1nc(NCC)c2ncn([C@H]3C[C@H](O)[C@@H](COP(=O)(O)O)O3)c2n1 |
| InChI | InChI=1S/C15H24N5O6PS/c1-3-5-28-15-18-13(16-4-2)12-14(19-15)20(8-17-12)11-6-9(21)10(26-11)7-25-27(22,23)24/h8-11,21H,3-7H2,1-2H3,(H,16,18,19)(H2,22,23,24)/t9-,10+,11+/m0/s1 |
| InChIKey | JMCRUMFSJJDGPG-HBNTYKKESA-N |
| XLogP | 1.52 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|