C18H22N5O7P — CID 5153147
[3-hydroxy-5-[6-[(2-hydroxy-2-phenylethyl)amino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 5153147) has the molecular formula C18H22N5O7P and a molecular weight of 451.38 g/mol. Its IUPAC name is [3-hydroxy-5-[6-[(2-hydroxy-2-phenylethyl)amino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [3-hydroxy-5-[6-[(2-hydroxy-2-phenylethyl)amino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 5153147 |
| Molecular Formula | C18H22N5O7P |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | [3-hydroxy-5-[6-[(2-hydroxy-2-phenylethyl)amino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCC1OC(n2cnc3c(NCC(O)c4ccccc4)ncnc32)CC1O |
| InChI | InChI=1S/C18H22N5O7P/c24-12-6-15(30-14(12)8-29-31(26,27)28)23-10-22-16-17(20-9-21-18(16)23)19-7-13(25)11-4-2-1-3-5-11/h1-5,9-10,12-15,24-25H,6-8H2,(H,19,20,21)(H2,26,27,28) |
| InChIKey | XQQQZMWASYSYAT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|