C22H40N5O12P3S — CID 139373208
[[(2R,3S,4R,5R)-5-[6-(butylamino)-2-propylsulfanylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-(2-dimethoxyphosphorylpropan-2-yl)phosphinic acid (PubChem CID 139373208) has the molecular formula C22H40N5O12P3S and a molecular weight of 691.57 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[6-(butylamino)-2-propylsulfanylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-(2-dimethoxyphosphorylpropan-2-yl)phosphinic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[6-(butylamino)-2-propylsulfanylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-(2-dimethoxyphosphorylpropan-2-yl)phosphinic acid |
|---|---|
| PubChem CID | 139373208 |
| Molecular Formula | C22H40N5O12P3S |
| Molecular Weight | 691.57 g/mol |
| Exact Mass | 691.16 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[6-(butylamino)-2-propylsulfanylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-(2-dimethoxyphosphorylpropan-2-yl)phosphinic acid |
| SMILES | CCCCNc1nc(SCCC)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)C(C)(C)P(=O)(OC)OC)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H40N5O12P3S/c1-7-9-10-23-18-15-19(26-21(25-18)43-11-8-2)27(13-24-15)20-17(29)16(28)14(38-20)12-37-42(33,34)39-40(30,31)22(3,4)41(32,35-5)36-6/h13-14,16-17,20,28-29H,7-12H2,1-6H3,(H,30,31)(H,33,34)(H,23,25,26)/t14-,16-,17-,20-/m1/s1 |
| InChIKey | SNRIABOSPMTXIL-WVSUBDOOSA-N |
| XLogP | 3.70 |
| TPSA | 233.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|