C17H30N5O13P3S2 — CID 46875581
[[(2R,3S,4R)-5-[6-amino-2-(7-sulfanylheptylsulfanyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 46875581) has the molecular formula C17H30N5O13P3S2 and a molecular weight of 669.50 g/mol. Its IUPAC name is [[(2R,3S,4R)-5-[6-amino-2-(7-sulfanylheptylsulfanyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R)-5-[6-amino-2-(7-sulfanylheptylsulfanyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 46875581 |
| Molecular Formula | C17H30N5O13P3S2 |
| Molecular Weight | 669.50 g/mol |
| Exact Mass | 669.05 |
| IUPAC Name | [[(2R,3S,4R)-5-[6-amino-2-(7-sulfanylheptylsulfanyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1nc(SCCCCCCCS)nc2c1ncn2C1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H30N5O13P3S2/c18-14-11-15(21-17(20-14)40-7-5-3-1-2-4-6-39)22(9-19-11)16-13(24)12(23)10(33-16)8-32-37(28,29)35-38(30,31)34-36(25,26)27/h9-10,12-13,16,23-24,39H,1-8H2,(H,28,29)(H,30,31)(H2,18,20,21)(H2,25,26,27)/t10-,12-,13-,16?/m1/s1 |
| InChIKey | PVUHOXOCMYUOKX-AARXTDBFSA-N |
| XLogP | 1.34 |
| TPSA | 279.13 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.50 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|