C16H26N5O6PS2 — CID 46876144
(3R,4S,5R)-2-(6-amino-2-hexylsulfanylpurin-9-yl)-5-(dihydroxyphosphinothioyloxymethyl)oxolane-3,4-diol (PubChem CID 46876144) has the molecular formula C16H26N5O6PS2 and a molecular weight of 479.52 g/mol. Its IUPAC name is (3R,4S,5R)-2-(6-amino-2-hexylsulfanylpurin-9-yl)-5-(dihydroxyphosphinothioyloxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-(6-amino-2-hexylsulfanylpurin-9-yl)-5-(dihydroxyphosphinothioyloxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 46876144 |
| Molecular Formula | C16H26N5O6PS2 |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | (3R,4S,5R)-2-(6-amino-2-hexylsulfanylpurin-9-yl)-5-(dihydroxyphosphinothioyloxymethyl)oxolane-3,4-diol |
| SMILES | CCCCCCSc1nc(N)c2ncn(C3O[C@H](COP(O)(O)=S)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C16H26N5O6PS2/c1-2-3-4-5-6-30-16-19-13(17)10-14(20-16)21(8-18-10)15-12(23)11(22)9(27-15)7-26-28(24,25)29/h8-9,11-12,15,22-23H,2-7H2,1H3,(H2,17,19,20)(H2,24,25,29)/t9-,11-,12-,15?/m1/s1 |
| InChIKey | DPAGUSSBIWVODX-FJFSNTMWSA-N |
| XLogP | 0.93 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|