C17H26BrN5O4S — CID 54392611
(2R,3R,4S,5R)-2-[6-amino-2-(7-bromoheptylsulfanyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 54392611) has the molecular formula C17H26BrN5O4S and a molecular weight of 476.40 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-2-(7-bromoheptylsulfanyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-2-(7-bromoheptylsulfanyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 54392611 |
| Molecular Formula | C17H26BrN5O4S |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-2-(7-bromoheptylsulfanyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(SCCCCCCCBr)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H26BrN5O4S/c18-6-4-2-1-3-5-7-28-17-21-14(19)11-15(22-17)23(9-20-11)16-13(26)12(25)10(8-24)27-16/h9-10,12-13,16,24-26H,1-8H2,(H2,19,21,22)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | VHSNIVPEEDJXOE-XNIJJKJLSA-N |
| XLogP | 1.46 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|