C16H25N5O10P2S — CID 46876184
[(2R,3S,4R)-5-(6-amino-2-hex-5-enylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 46876184) has the molecular formula C16H25N5O10P2S and a molecular weight of 541.42 g/mol. Its IUPAC name is [(2R,3S,4R)-5-(6-amino-2-hex-5-enylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,4R)-5-(6-amino-2-hex-5-enylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 46876184 |
| Molecular Formula | C16H25N5O10P2S |
| Molecular Weight | 541.42 g/mol |
| Exact Mass | 541.08 |
| IUPAC Name | [(2R,3S,4R)-5-(6-amino-2-hex-5-enylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | C=CCCCCSc1nc(N)c2ncn(C3O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C16H25N5O10P2S/c1-2-3-4-5-6-34-16-19-13(17)10-14(20-16)21(8-18-10)15-12(23)11(22)9(30-15)7-29-33(27,28)31-32(24,25)26/h2,8-9,11-12,15,22-23H,1,3-7H2,(H,27,28)(H2,17,19,20)(H2,24,25,26)/t9-,11-,12-,15?/m1/s1 |
| InChIKey | RXXMLCRJSLVSTR-FJFSNTMWSA-N |
| XLogP | 0.70 |
| TPSA | 232.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.42 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|