C41H54N8O5 — CID 15403874
(2R,3S,5R)-5-[6-[3-[4-(3-aminopropylamino)butylamino]propylamino]purin-9-yl]-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol (PubChem CID 15403874) has the molecular formula C41H54N8O5 and a molecular weight of 738.93 g/mol. Its IUPAC name is (2R,3S,5R)-5-[6-[3-[4-(3-aminopropylamino)butylamino]propylamino]purin-9-yl]-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-[6-[3-[4-(3-aminopropylamino)butylamino]propylamino]purin-9-yl]-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 15403874 |
| Molecular Formula | C41H54N8O5 |
| Molecular Weight | 738.93 g/mol |
| Exact Mass | 738.42 |
| IUPAC Name | (2R,3S,5R)-5-[6-[3-[4-(3-aminopropylamino)butylamino]propylamino]purin-9-yl]-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NCCCNCCCCNCCCN)ncnc43)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C41H54N8O5/c1-51-33-16-12-31(13-17-33)41(30-10-4-3-5-11-30,32-14-18-34(52-2)19-15-32)53-27-36-35(50)26-37(54-36)49-29-48-38-39(46-28-47-40(38)49)45-25-9-24-44-22-7-6-21-43-23-8-20-42/h3-5,10-19,28-29,35-37,43-44,50H,6-9,20-27,42H2,1-2H3,(H,45,46,47)/t35-,36+,37+/m0/s1 |
| InChIKey | FTFACEDPBDQTSD-HKIDPNTFSA-N |
| XLogP | 4.61 |
| TPSA | 162.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.93 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|