C49H70N8O5 — CID 101176732
(2R,3S,5S)-5-[2,6-bis[[bis(2-methylpropyl)amino]methylamino]purin-9-yl]-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol (PubChem CID 101176732) has the molecular formula C49H70N8O5 and a molecular weight of 851.15 g/mol. Its IUPAC name is (2R,3S,5S)-5-[2,6-bis[[bis(2-methylpropyl)amino]methylamino]purin-9-yl]-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol.
| Compound Name | (2R,3S,5S)-5-[2,6-bis[[bis(2-methylpropyl)amino]methylamino]purin-9-yl]-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 101176732 |
| Molecular Formula | C49H70N8O5 |
| Molecular Weight | 851.15 g/mol |
| Exact Mass | 850.55 |
| IUPAC Name | (2R,3S,5S)-5-[2,6-bis[[bis(2-methylpropyl)amino]methylamino]purin-9-yl]-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol |
| SMILES | COc1ccc(C(OC[C@H]2O[C@H](n3cnc4c(NCN(CC(C)C)CC(C)C)nc(NCN(CC(C)C)CC(C)C)nc43)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C49H70N8O5/c1-33(2)25-55(26-34(3)4)30-51-46-45-47(54-48(53-46)52-31-56(27-35(5)6)28-36(7)8)57(32-50-45)44-24-42(58)43(62-44)29-61-49(37-14-12-11-13-15-37,38-16-20-40(59-9)21-17-38)39-18-22-41(60-10)23-19-39/h11-23,32-36,42-44,58H,24-31H2,1-10H3,(H2,51,52,53,54)/t42-,43+,44-/m0/s1 |
| InChIKey | BIZSUENSQZMMAA-AOQBRIPDSA-N |
| XLogP | 8.47 |
| TPSA | 131.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.15 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|