C48H46N6O8 — CID 4979330
[9-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-(2-methylpropanoylamino)purin-6-yl] N,N-diphenylcarbamate (PubChem CID 4979330) has the molecular formula C48H46N6O8 and a molecular weight of 834.93 g/mol. Its IUPAC name is [9-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-(2-methylpropanoylamino)purin-6-yl] N,N-diphenylcarbamate.
| Compound Name | [9-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-(2-methylpropanoylamino)purin-6-yl] N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 4979330 |
| Molecular Formula | C48H46N6O8 |
| Molecular Weight | 834.93 g/mol |
| Exact Mass | 834.34 |
| IUPAC Name | [9-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-(2-methylpropanoylamino)purin-6-yl] N,N-diphenylcarbamate |
| SMILES | COc1ccc(C(OCC2OC(n3cnc4c(OC(=O)N(c5ccccc5)c5ccccc5)nc(NC(=O)C(C)C)nc43)CC2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C48H46N6O8/c1-31(2)44(56)51-46-50-43-42(45(52-46)62-47(57)54(35-16-10-6-11-17-35)36-18-12-7-13-19-36)49-30-53(43)41-28-39(55)40(61-41)29-60-48(32-14-8-5-9-15-32,33-20-24-37(58-3)25-21-33)34-22-26-38(59-4)27-23-34/h5-27,30-31,39-41,55H,28-29H2,1-4H3,(H,50,51,52,56) |
| InChIKey | GZVCYLPLBHGGSQ-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 159.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.93 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|