C38H42N6O9S — CID 169132159
[9-[(2R,5R)-5-(hydroxymethyl)-4-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]oxolan-2-yl]-2-(2-methylpropanoylamino)purin-6-yl] N,N-diphenylcarbamate (PubChem CID 169132159) has the molecular formula C38H42N6O9S and a molecular weight of 758.85 g/mol. Its IUPAC name is [9-[(2R,5R)-5-(hydroxymethyl)-4-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]oxolan-2-yl]-2-(2-methylpropanoylamino)purin-6-yl] N,N-diphenylcarbamate.
| Compound Name | [9-[(2R,5R)-5-(hydroxymethyl)-4-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]oxolan-2-yl]-2-(2-methylpropanoylamino)purin-6-yl] N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 169132159 |
| Molecular Formula | C38H42N6O9S |
| Molecular Weight | 758.85 g/mol |
| Exact Mass | 758.27 |
| IUPAC Name | [9-[(2R,5R)-5-(hydroxymethyl)-4-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]oxolan-2-yl]-2-(2-methylpropanoylamino)purin-6-yl] N,N-diphenylcarbamate |
| SMILES | COc1cc(OC)c(CSCOC2C[C@H](n3cnc4c(OC(=O)N(c5ccccc5)c5ccccc5)nc(NC(=O)C(C)C)nc43)O[C@@H]2CO)c(OC)c1 |
| InChI | InChI=1S/C38H42N6O9S/c1-23(2)35(46)41-37-40-34-33(36(42-37)53-38(47)44(24-12-8-6-9-13-24)25-14-10-7-11-15-25)39-21-43(34)32-18-30(31(19-45)52-32)51-22-54-20-27-28(49-4)16-26(48-3)17-29(27)50-5/h6-17,21,23,30-32,45H,18-20,22H2,1-5H3,(H,40,41,42,46)/t30?,31-,32-/m1/s1 |
| InChIKey | ZOZPNNANLAEVHG-YPHBKRNWSA-N |
| XLogP | 6.34 |
| TPSA | 168.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.85 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|