C19H29N5O5S2 — CID 140914346
N-[9-[(2R,5R)-4-[(tert-butyldisulfanyl)methoxy]-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide (PubChem CID 140914346) has the molecular formula C19H29N5O5S2 and a molecular weight of 471.61 g/mol. Its IUPAC name is N-[9-[(2R,5R)-4-[(tert-butyldisulfanyl)methoxy]-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(2R,5R)-4-[(tert-butyldisulfanyl)methoxy]-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 140914346 |
| Molecular Formula | C19H29N5O5S2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N-[9-[(2R,5R)-4-[(tert-butyldisulfanyl)methoxy]-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1nc2c(ncn2[C@H]2CC(OCSSC(C)(C)C)[C@@H](CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C19H29N5O5S2/c1-10(2)16(26)22-18-21-15-14(17(27)23-18)20-8-24(15)13-6-11(12(7-25)29-13)28-9-30-31-19(3,4)5/h8,10-13,25H,6-7,9H2,1-5H3,(H2,21,22,23,26,27)/t11?,12-,13-/m1/s1 |
| InChIKey | NRTLCPKECNRDJO-VFRRUGBOSA-N |
| XLogP | 2.52 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|