C14H18IN5O4 — CID 136675416
N-[9-[(2R,4S,5S)-4-hydroxy-5-(iodomethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide (PubChem CID 136675416) has the molecular formula C14H18IN5O4 and a molecular weight of 447.23 g/mol. Its IUPAC name is N-[9-[(2R,4S,5S)-4-hydroxy-5-(iodomethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(2R,4S,5S)-4-hydroxy-5-(iodomethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 136675416 |
| Molecular Formula | C14H18IN5O4 |
| Molecular Weight | 447.23 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | N-[9-[(2R,4S,5S)-4-hydroxy-5-(iodomethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1nc2c(ncn2[C@H]2C[C@H](O)[C@@H](CI)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H18IN5O4/c1-6(2)12(22)18-14-17-11-10(13(23)19-14)16-5-20(11)9-3-7(21)8(4-15)24-9/h5-9,21H,3-4H2,1-2H3,(H2,17,18,19,22,23)/t7-,8+,9+/m0/s1 |
| InChIKey | CHVWGBZGQUIOCT-DJLDLDEBSA-N |
| XLogP | 0.80 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|