C18H28N4O3S2 — CID 158497283
9-[(2R,5R)-4-[(tert-butyldisulfanyl)methoxy]-5-propyloxolan-2-yl]-2-methyl-1H-purin-6-one (PubChem CID 158497283) has the molecular formula C18H28N4O3S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 9-[(2R,5R)-4-[(tert-butyldisulfanyl)methoxy]-5-propyloxolan-2-yl]-2-methyl-1H-purin-6-one.
| Compound Name | 9-[(2R,5R)-4-[(tert-butyldisulfanyl)methoxy]-5-propyloxolan-2-yl]-2-methyl-1H-purin-6-one |
|---|---|
| PubChem CID | 158497283 |
| Molecular Formula | C18H28N4O3S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 9-[(2R,5R)-4-[(tert-butyldisulfanyl)methoxy]-5-propyloxolan-2-yl]-2-methyl-1H-purin-6-one |
| SMILES | CCC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(C)nc32)CC1OCSSC(C)(C)C |
| InChI | InChI=1S/C18H28N4O3S2/c1-6-7-12-13(24-10-26-27-18(3,4)5)8-14(25-12)22-9-19-15-16(22)20-11(2)21-17(15)23/h9,12-14H,6-8,10H2,1-5H3,(H,20,21,23)/t12-,13?,14-/m1/s1 |
| InChIKey | BSANYYZBJVPWTD-WYAMFQBQSA-N |
| XLogP | 4.04 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|