C26H41N8O8P — CID 165086787
tert-butylazanium;[(2R,5R)-2-ethyl-5-(4-methyl-2-oxo-1,3,5-triazin-1-yl)oxolan-3-yl] [(2S,5R)-3-methyl-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl phosphate (PubChem CID 165086787) has the molecular formula C26H41N8O8P and a molecular weight of 624.64 g/mol. Its IUPAC name is tert-butylazanium;[(2R,5R)-2-ethyl-5-(4-methyl-2-oxo-1,3,5-triazin-1-yl)oxolan-3-yl] [(2S,5R)-3-methyl-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl phosphate.
| Compound Name | tert-butylazanium;[(2R,5R)-2-ethyl-5-(4-methyl-2-oxo-1,3,5-triazin-1-yl)oxolan-3-yl] [(2S,5R)-3-methyl-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 165086787 |
| Molecular Formula | C26H41N8O8P |
| Molecular Weight | 624.64 g/mol |
| Exact Mass | 624.28 |
| IUPAC Name | tert-butylazanium;[(2R,5R)-2-ethyl-5-(4-methyl-2-oxo-1,3,5-triazin-1-yl)oxolan-3-yl] [(2S,5R)-3-methyl-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl phosphate |
| SMILES | CC(C)(C)[NH3+].CC[C@H]1O[C@@H](n2cnc(C)nc2=O)CC1OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(C)nc32)CC1C |
| InChI | InChI=1S/C22H30N7O8P.C4H11N/c1-5-14-15(7-18(35-14)29-9-23-12(3)27-22(29)31)37-38(32,33)34-8-16-11(2)6-17(36-16)28-10-24-19-20(28)25-13(4)26-21(19)30;1-4(2,3)5/h9-11,14-18H,5-8H2,1-4H3,(H,32,33)(H,25,26,30);5H2,1-3H3/t11?,14-,15?,16-,17-,18-;/m1./s1 |
| InChIKey | WAOWOCSSXNYKPO-LBIPQEMPSA-N |
| XLogP | 0.91 |
| TPSA | 216.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.64 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|