C16H27N3O3S2 — CID 153455739
4-amino-1-[(2R,5R)-4-[(tert-butyldisulfanyl)methoxy]-5-propyloxolan-2-yl]pyrimidin-2-one (PubChem CID 153455739) has the molecular formula C16H27N3O3S2 and a molecular weight of 373.54 g/mol. Its IUPAC name is 4-amino-1-[(2R,5R)-4-[(tert-butyldisulfanyl)methoxy]-5-propyloxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,5R)-4-[(tert-butyldisulfanyl)methoxy]-5-propyloxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 153455739 |
| Molecular Formula | C16H27N3O3S2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 4-amino-1-[(2R,5R)-4-[(tert-butyldisulfanyl)methoxy]-5-propyloxolan-2-yl]pyrimidin-2-one |
| SMILES | CCC[C@H]1O[C@@H](n2ccc(N)nc2=O)CC1OCSSC(C)(C)C |
| InChI | InChI=1S/C16H27N3O3S2/c1-5-6-11-12(21-10-23-24-16(2,3)4)9-14(22-11)19-8-7-13(17)18-15(19)20/h7-8,11-12,14H,5-6,9-10H2,1-4H3,(H2,17,18,20)/t11-,12?,14-/m1/s1 |
| InChIKey | CZNYGYQLLHVGMY-YXHCSQSYSA-N |
| XLogP | 3.44 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|