C11H17N3O3 — CID 58332720
4-amino-1-[(2R,4S,5R)-5-ethyl-4-methoxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 58332720) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 4-amino-1-[(2R,4S,5R)-5-ethyl-4-methoxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4S,5R)-5-ethyl-4-methoxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 58332720 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 4-amino-1-[(2R,4S,5R)-5-ethyl-4-methoxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | CC[C@H]1O[C@@H](n2ccc(N)nc2=O)C[C@@H]1OC |
| InChI | InChI=1S/C11H17N3O3/c1-3-7-8(16-2)6-10(17-7)14-5-4-9(12)13-11(14)15/h4-5,7-8,10H,3,6H2,1-2H3,(H2,12,13,15)/t7-,8+,10-/m1/s1 |
| InChIKey | YMQIBYDLGRMBBV-KHQFGBGNSA-N |
| XLogP | 0.54 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |