C19H33N3O4 — CID 69432831
4-amino-1-[(2R,5R)-4-pentoxy-5-(pentoxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 69432831) has the molecular formula C19H33N3O4 and a molecular weight of 367.49 g/mol. Its IUPAC name is 4-amino-1-[(2R,5R)-4-pentoxy-5-(pentoxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,5R)-4-pentoxy-5-(pentoxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 69432831 |
| Molecular Formula | C19H33N3O4 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 4-amino-1-[(2R,5R)-4-pentoxy-5-(pentoxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | CCCCCOC[C@H]1O[C@@H](n2ccc(N)nc2=O)CC1OCCCCC |
| InChI | InChI=1S/C19H33N3O4/c1-3-5-7-11-24-14-16-15(25-12-8-6-4-2)13-18(26-16)22-10-9-17(20)21-19(22)23/h9-10,15-16,18H,3-8,11-14H2,1-2H3,(H2,20,21,23)/t15?,16-,18-/m1/s1 |
| InChIKey | UAESCEJYGRLNTI-WOEZKJSCSA-N |
| XLogP | 2.90 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|