C12H17N3O4 — CID 58060006
4-amino-1-[(2R,5R)-5-(hydroxymethyl)-4-prop-2-enoxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 58060006) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-amino-1-[(2R,5R)-5-(hydroxymethyl)-4-prop-2-enoxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,5R)-5-(hydroxymethyl)-4-prop-2-enoxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 58060006 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 4-amino-1-[(2R,5R)-5-(hydroxymethyl)-4-prop-2-enoxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | C=CCOC1C[C@H](n2ccc(N)nc2=O)O[C@@H]1CO |
| InChI | InChI=1S/C12H17N3O4/c1-2-5-18-8-6-11(19-9(8)7-16)15-4-3-10(13)14-12(15)17/h2-4,8-9,11,16H,1,5-7H2,(H2,13,14,17)/t8?,9-,11-/m1/s1 |
| InChIKey | DHERLSSHEFFJJF-HOGWDWRMSA-N |
| XLogP | -0.32 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|