C9H12BN3O7P — CID 67780611
CID 67780611 (PubChem CID 67780611) has the molecular formula C9H12BN3O7P and a molecular weight of 316.00 g/mol.
| Compound Name | CID 67780611 |
|---|---|
| PubChem CID | 67780611 |
| Molecular Formula | C9H12BN3O7P |
| Molecular Weight | 316.00 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | — |
| SMILES | Nc1ccn([C@H]2C[C@H](OP3(=O)O[B]O3)[C@@H](CO)O2)c(=O)n1 |
| InChI | InChI=1S/C9H12BN3O7P/c11-7-1-2-13(9(15)12-7)8-3-5(6(4-14)17-8)18-21(16)19-10-20-21/h1-2,5-6,8,14H,3-4H2,(H2,11,12,15)/t5-,6+,8+/m0/s1 |
| InChIKey | CLOOODYPKSCFPY-SHYZEUOFSA-N |
| XLogP | -0.82 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.00 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|