C25H41N3O6 — CID 142834334
[5-(4-amino-2-oxopyrimidin-1-yl)-3-octanoyloxyoxolan-2-yl]methyl octanoate (PubChem CID 142834334) has the molecular formula C25H41N3O6 and a molecular weight of 479.62 g/mol. Its IUPAC name is [5-(4-amino-2-oxopyrimidin-1-yl)-3-octanoyloxyoxolan-2-yl]methyl octanoate.
| Compound Name | [5-(4-amino-2-oxopyrimidin-1-yl)-3-octanoyloxyoxolan-2-yl]methyl octanoate |
|---|---|
| PubChem CID | 142834334 |
| Molecular Formula | C25H41N3O6 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | [5-(4-amino-2-oxopyrimidin-1-yl)-3-octanoyloxyoxolan-2-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OCC1OC(n2ccc(N)nc2=O)CC1OC(=O)CCCCCCC |
| InChI | InChI=1S/C25H41N3O6/c1-3-5-7-9-11-13-23(29)32-18-20-19(34-24(30)14-12-10-8-6-4-2)17-22(33-20)28-16-15-21(26)27-25(28)31/h15-16,19-20,22H,3-14,17-18H2,1-2H3,(H2,26,27,31) |
| InChIKey | UPRJTGHYRHXMCV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|