C14H19N3O6 — CID 87750472
[(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 5-oxopentanoate (PubChem CID 87750472) has the molecular formula C14H19N3O6 and a molecular weight of 325.32 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 5-oxopentanoate.
| Compound Name | [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 5-oxopentanoate |
|---|---|
| PubChem CID | 87750472 |
| Molecular Formula | C14H19N3O6 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 5-oxopentanoate |
| SMILES | Nc1ccn([C@H]2C[C@H](O)[C@@H](COC(=O)CCCC=O)O2)c(=O)n1 |
| InChI | InChI=1S/C14H19N3O6/c15-11-4-5-17(14(21)16-11)12-7-9(19)10(23-12)8-22-13(20)3-1-2-6-18/h4-6,9-10,12,19H,1-3,7-8H2,(H2,15,16,21)/t9-,10+,12+/m0/s1 |
| InChIKey | UWHOOHMWGRLNHM-HOSYDEDBSA-N |
| XLogP | -0.61 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|