C29H36N4O5 — CID 174013428
[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[(2,2-dimethyl-1,1-diphenylpropoxy)methyl]oxolan-3-yl] 3-aminopropanoate (PubChem CID 174013428) has the molecular formula C29H36N4O5 and a molecular weight of 520.63 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[(2,2-dimethyl-1,1-diphenylpropoxy)methyl]oxolan-3-yl] 3-aminopropanoate.
| Compound Name | [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[(2,2-dimethyl-1,1-diphenylpropoxy)methyl]oxolan-3-yl] 3-aminopropanoate |
|---|---|
| PubChem CID | 174013428 |
| Molecular Formula | C29H36N4O5 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[(2,2-dimethyl-1,1-diphenylpropoxy)methyl]oxolan-3-yl] 3-aminopropanoate |
| SMILES | CC(C)(C)C(OC[C@H]1O[C@@H](n2ccc(N)nc2=O)C[C@H]1OC(=O)CCN)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H36N4O5/c1-28(2,3)29(20-10-6-4-7-11-20,21-12-8-5-9-13-21)36-19-23-22(38-26(34)14-16-30)18-25(37-23)33-17-15-24(31)32-27(33)35/h4-13,15,17,22-23,25H,14,16,18-19,30H2,1-3H3,(H2,31,32,35)/t22-,23-,25-/m1/s1 |
| InChIKey | QHHLMHWPTRBKFJ-VDKIKQQVSA-N |
| XLogP | 3.38 |
| TPSA | 131.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |