C30H30N3O6PS2 — CID 10556865
[(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-sulfanylidene-sulfidophosphanium (PubChem CID 10556865) has the molecular formula C30H30N3O6PS2 and a molecular weight of 623.69 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-sulfanylidene-sulfidophosphanium.
| Compound Name | [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-sulfanylidene-sulfidophosphanium |
|---|---|
| PubChem CID | 10556865 |
| Molecular Formula | C30H30N3O6PS2 |
| Molecular Weight | 623.69 g/mol |
| Exact Mass | 623.13 |
| IUPAC Name | [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-sulfanylidene-sulfidophosphanium |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(N)nc3=O)C[C@@H]2O[P+](=S)[S-])(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H30N3O6PS2/c1-35-23-12-8-21(9-13-23)30(20-6-4-3-5-7-20,22-10-14-24(36-2)15-11-22)37-19-26-25(39-40(41)42)18-28(38-26)33-17-16-27(31)32-29(33)34/h3-17,25-26,28H,18-19H2,1-2H3,(H2,31,32,34)/t25-,26+,28+/m0/s1 |
| InChIKey | MEFOCMZJSFCXFN-ZRRKCSAHSA-N |
| XLogP | 4.84 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.69 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|