C37H36N2O9P+ — CID 12071204
[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2-oxo-4-phenoxypyrimidin-1-yl)oxolan-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 12071204) has the molecular formula C37H36N2O9P+ and a molecular weight of 683.67 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2-oxo-4-phenoxypyrimidin-1-yl)oxolan-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2-oxo-4-phenoxypyrimidin-1-yl)oxolan-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 12071204 |
| Molecular Formula | C37H36N2O9P+ |
| Molecular Weight | 683.67 g/mol |
| Exact Mass | 683.22 |
| IUPAC Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2-oxo-4-phenoxypyrimidin-1-yl)oxolan-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(Oc4ccccc4)nc3=O)C[C@@H]2O[P+](=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H35N2O9P/c1-25-23-39(36(40)38-35(25)46-31-12-8-5-9-13-31)34-22-32(48-49(41)42)33(47-34)24-45-37(26-10-6-4-7-11-26,27-14-18-29(43-2)19-15-27)28-16-20-30(44-3)21-17-28/h4-21,23,32-34H,22,24H2,1-3H3/p+1/t32-,33+,34+/m0/s1 |
| InChIKey | YKDMLUJFWOYUSU-LBFZIJHGSA-O |
| XLogP | 6.69 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.67 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|