C33H37N5O8P+ — CID 102587716
[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[5-methyl-4-[(N'-methylcarbamimidoyl)amino]-2-oxopyrimidin-1-yl]oxolan-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 102587716) has the molecular formula C33H37N5O8P+ and a molecular weight of 662.66 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[5-methyl-4-[(N'-methylcarbamimidoyl)amino]-2-oxopyrimidin-1-yl]oxolan-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[5-methyl-4-[(N'-methylcarbamimidoyl)amino]-2-oxopyrimidin-1-yl]oxolan-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 102587716 |
| Molecular Formula | C33H37N5O8P+ |
| Molecular Weight | 662.66 g/mol |
| Exact Mass | 662.24 |
| IUPAC Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[5-methyl-4-[(N'-methylcarbamimidoyl)amino]-2-oxopyrimidin-1-yl]oxolan-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | C/N=C(\N)Nc1nc(=O)n([C@H]2C[C@H](O[P+](=O)O)[C@@H](COC(c3ccccc3)(c3ccc(OC)cc3)c3ccc(OC)cc3)O2)cc1C |
| InChI | InChI=1S/C33H36N5O8P/c1-21-19-38(32(39)37-30(21)36-31(34)35-2)29-18-27(46-47(40)41)28(45-29)20-44-33(22-8-6-5-7-9-22,23-10-14-25(42-3)15-11-23)24-12-16-26(43-4)17-13-24/h5-17,19,27-29H,18,20H2,1-4H3,(H3-,34,35,36,37,39,40,41)/p+1/t27-,28+,29+/m0/s1 |
| InChIKey | UCKNYLJEYJHDRK-ZGIBFIJWSA-O |
| XLogP | 4.26 |
| TPSA | 168.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.66 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|