C35H36N3O9P — CID 102068603
N-[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[hydroxy(oxo)phosphaniumyl]oxyoxolan-2-yl]-2-oxopyrimidin-4-yl]pent-4-enimidate (PubChem CID 102068603) has the molecular formula C35H36N3O9P and a molecular weight of 673.66 g/mol. Its IUPAC name is N-[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[hydroxy(oxo)phosphaniumyl]oxyoxolan-2-yl]-2-oxopyrimidin-4-yl]pent-4-enimidate.
| Compound Name | N-[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[hydroxy(oxo)phosphaniumyl]oxyoxolan-2-yl]-2-oxopyrimidin-4-yl]pent-4-enimidate |
|---|---|
| PubChem CID | 102068603 |
| Molecular Formula | C35H36N3O9P |
| Molecular Weight | 673.66 g/mol |
| Exact Mass | 673.22 |
| IUPAC Name | N-[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[hydroxy(oxo)phosphaniumyl]oxyoxolan-2-yl]-2-oxopyrimidin-4-yl]pent-4-enimidate |
| SMILES | C=CCC/C([O-])=N/c1ccn([C@H]2C[C@H](O[P+](=O)O)[C@@H](COC(c3ccccc3)(c3ccc(OC)cc3)c3ccc(OC)cc3)O2)c(=O)n1 |
| InChI | InChI=1S/C35H36N3O9P/c1-4-5-11-32(39)36-31-20-21-38(34(40)37-31)33-22-29(47-48(41)42)30(46-33)23-45-35(24-9-7-6-8-10-24,25-12-16-27(43-2)17-13-25)26-14-18-28(44-3)19-15-26/h4,6-10,12-21,29-30,33H,1,5,11,22-23H2,2-3H3,(H-,36,37,39,40,41,42)/t29-,30+,33+/m0/s1 |
| InChIKey | WYAFMOGPUKVHEW-AARCXHMLSA-N |
| XLogP | 4.95 |
| TPSA | 153.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|