C15H25N3O5 — CID 22844691
4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(6-hydroxyhexoxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 22844691) has the molecular formula C15H25N3O5 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(6-hydroxyhexoxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(6-hydroxyhexoxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 22844691 |
| Molecular Formula | C15H25N3O5 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(6-hydroxyhexoxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@H]2C[C@H](O)[C@@H](COCCCCCCO)O2)c(=O)n1 |
| InChI | InChI=1S/C15H25N3O5/c16-13-5-6-18(15(21)17-13)14-9-11(20)12(23-14)10-22-8-4-2-1-3-7-19/h5-6,11-12,14,19-20H,1-4,7-10H2,(H2,16,17,21)/t11-,12+,14+/m0/s1 |
| InChIKey | DZJPYGDOMCFEFT-OUCADQQQSA-N |
| XLogP | 0.04 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|