C21H29N3O7S — CID 169132155
4-amino-1-[5-(2-hydroxyethyl)-4-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]oxolan-2-yl]pyrimidin-2-one (PubChem CID 169132155) has the molecular formula C21H29N3O7S and a molecular weight of 467.54 g/mol. Its IUPAC name is 4-amino-1-[5-(2-hydroxyethyl)-4-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[5-(2-hydroxyethyl)-4-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 169132155 |
| Molecular Formula | C21H29N3O7S |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 4-amino-1-[5-(2-hydroxyethyl)-4-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]oxolan-2-yl]pyrimidin-2-one |
| SMILES | COc1cc(OC)c(CSCOC2CC(n3ccc(N)nc3=O)OC2CCO)c(OC)c1 |
| InChI | InChI=1S/C21H29N3O7S/c1-27-13-8-16(28-2)14(17(9-13)29-3)11-32-12-30-18-10-20(31-15(18)5-7-25)24-6-4-19(22)23-21(24)26/h4,6,8-9,15,18,20,25H,5,7,10-12H2,1-3H3,(H2,22,23,26) |
| InChIKey | ADMXIJFJFQTBJT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|