C21H30N5O15P3S — CID 176747702
[[(2R,3R,5R)-5-(6-aminopurin-9-yl)-3-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 176747702) has the molecular formula C21H30N5O15P3S and a molecular weight of 717.48 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-(6-aminopurin-9-yl)-3-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5R)-5-(6-aminopurin-9-yl)-3-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 176747702 |
| Molecular Formula | C21H30N5O15P3S |
| Molecular Weight | 717.48 g/mol |
| Exact Mass | 717.07 |
| IUPAC Name | [[(2R,3R,5R)-5-(6-aminopurin-9-yl)-3-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | COc1cc(OC)c(CSCO[C@@H]2C[C@H](n3cnc4c(N)ncnc43)O[C@@H]2COP(=O)(O)OP(=O)(O)OP(=O)(O)O)c(OC)c1 |
| InChI | InChI=1S/C21H30N5O15P3S/c1-34-12-4-14(35-2)13(15(5-12)36-3)8-45-11-37-16-6-18(26-10-25-19-20(22)23-9-24-21(19)26)39-17(16)7-38-43(30,31)41-44(32,33)40-42(27,28)29/h4-5,9-10,16-18H,6-8,11H2,1-3H3,(H,30,31)(H,32,33)(H2,22,23,24)(H2,27,28,29)/t16-,17-,18-/m1/s1 |
| InChIKey | SKWGUIALSYNJCH-KZNAEPCWSA-N |
| XLogP | 2.34 |
| TPSA | 275.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|