C21H27N5O8PS+ — CID 139341910
[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]oxolan-2-yl]methoxy-hydroxy-oxophosphanium (PubChem CID 139341910) has the molecular formula C21H27N5O8PS+ and a molecular weight of 540.52 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]oxolan-2-yl]methoxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]oxolan-2-yl]methoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 139341910 |
| Molecular Formula | C21H27N5O8PS+ |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]oxolan-2-yl]methoxy-hydroxy-oxophosphanium |
| SMILES | COc1cc(OC)c(CSCO[C@H]2C[C@H](n3cnc4c(N)ncnc43)O[C@@H]2CO[P+](=O)O)c(OC)c1 |
| InChI | InChI=1S/C21H26N5O8PS/c1-29-12-4-14(30-2)13(15(5-12)31-3)8-36-11-32-16-6-18(34-17(16)7-33-35(27)28)26-10-25-19-20(22)23-9-24-21(19)26/h4-5,9-10,16-18H,6-8,11H2,1-3H3,(H2-,22,23,24,27,28)/p+1/t16-,17+,18+/m0/s1 |
| InChIKey | UTDLKAKXWLWLBF-RCCFBDPRSA-O |
| XLogP | 2.66 |
| TPSA | 162.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|