C22H36N3O13P3S2 — CID 160748613
[[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[[[4-(2-bicyclo[2.2.1]hept-5-enyl)-2-methylbutan-2-yl]disulfanyl]methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 160748613) has the molecular formula C22H36N3O13P3S2 and a molecular weight of 707.59 g/mol. Its IUPAC name is [[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[[[4-(2-bicyclo[2.2.1]hept-5-enyl)-2-methylbutan-2-yl]disulfanyl]methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[[[4-(2-bicyclo[2.2.1]hept-5-enyl)-2-methylbutan-2-yl]disulfanyl]methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 160748613 |
| Molecular Formula | C22H36N3O13P3S2 |
| Molecular Weight | 707.59 g/mol |
| Exact Mass | 707.09 |
| IUPAC Name | [[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[[[4-(2-bicyclo[2.2.1]hept-5-enyl)-2-methylbutan-2-yl]disulfanyl]methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(C)(CCC1CC2C=CC1C2)SSCOC1C[C@H](n2ccc(N)nc2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C22H36N3O13P3S2/c1-22(2,7-5-16-10-14-3-4-15(16)9-14)43-42-13-34-17-11-20(25-8-6-19(23)24-21(25)26)36-18(17)12-35-40(30,31)38-41(32,33)37-39(27,28)29/h3-4,6,8,14-18,20H,5,7,9-13H2,1-2H3,(H,30,31)(H,32,33)(H2,23,24,26)(H2,27,28,29)/t14?,15?,16?,17?,18-,20-/m1/s1 |
| InChIKey | RWNBVHNADIUPJV-LAUAMQEHSA-N |
| XLogP | 3.95 |
| TPSA | 239.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|