C18H28N5O13P3S2 — CID 174037896
[[(3R,5R)-5-[2-amino-5-(2-aminoethynyl)-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]-3-[(tert-butyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 174037896) has the molecular formula C18H28N5O13P3S2 and a molecular weight of 679.50 g/mol. Its IUPAC name is [[(3R,5R)-5-[2-amino-5-(2-aminoethynyl)-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]-3-[(tert-butyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(3R,5R)-5-[2-amino-5-(2-aminoethynyl)-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]-3-[(tert-butyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174037896 |
| Molecular Formula | C18H28N5O13P3S2 |
| Molecular Weight | 679.50 g/mol |
| Exact Mass | 679.03 |
| IUPAC Name | [[(3R,5R)-5-[2-amino-5-(2-aminoethynyl)-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]-3-[(tert-butyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(C)(C)SSCO[C@@H]1C[C@H](n2cc(C#CN)c3c(=O)[nH]c(N)nc32)OC1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C18H28N5O13P3S2/c1-18(2,3)41-40-9-32-11-6-13(23-7-10(4-5-19)14-15(23)21-17(20)22-16(14)24)34-12(11)8-33-38(28,29)36-39(30,31)35-37(25,26)27/h7,11-13H,6,8-9,19H2,1-3H3,(H,28,29)(H,30,31)(H2,25,26,27)(H3,20,21,22,24)/t11-,12?,13-/m1/s1 |
| InChIKey | FUKRKTWPJKUWIM-LKOMHFJYSA-N |
| XLogP | 1.73 |
| TPSA | 281.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|