C14H22N3O14P3S2 — CID 129121118
[[(3R,5R)-5-[5-(3-aminoprop-1-ynyl)-2,4-dioxopyrimidin-1-yl]-3-[(methyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 129121118) has the molecular formula C14H22N3O14P3S2 and a molecular weight of 613.39 g/mol. Its IUPAC name is [[(3R,5R)-5-[5-(3-aminoprop-1-ynyl)-2,4-dioxopyrimidin-1-yl]-3-[(methyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(3R,5R)-5-[5-(3-aminoprop-1-ynyl)-2,4-dioxopyrimidin-1-yl]-3-[(methyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 129121118 |
| Molecular Formula | C14H22N3O14P3S2 |
| Molecular Weight | 613.39 g/mol |
| Exact Mass | 612.98 |
| IUPAC Name | [[(3R,5R)-5-[5-(3-aminoprop-1-ynyl)-2,4-dioxopyrimidin-1-yl]-3-[(methyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CSSCO[C@@H]1C[C@H](n2cc(C#CCN)c(=O)[nH]c2=O)OC1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C14H22N3O14P3S2/c1-35-36-8-27-10-5-12(17-6-9(3-2-4-15)13(18)16-14(17)19)29-11(10)7-28-33(23,24)31-34(25,26)30-32(20,21)22/h6,10-12H,4-5,7-8,15H2,1H3,(H,23,24)(H,25,26)(H,16,18,19)(H2,20,21,22)/t10-,11?,12-/m1/s1 |
| InChIKey | NNYAHJLYVIKLAF-IGBJHFKCSA-N |
| XLogP | -0.17 |
| TPSA | 259.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.39 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|