C17H29N4O15P3S2 — CID 166508204
[[(2R,5R)-5-[5-[3-[[(1-amino-2-methylpropan-2-yl)disulfanyl]methoxy]prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]-3-aminooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 166508204) has the molecular formula C17H29N4O15P3S2 and a molecular weight of 686.49 g/mol. Its IUPAC name is [[(2R,5R)-5-[5-[3-[[(1-amino-2-methylpropan-2-yl)disulfanyl]methoxy]prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]-3-aminooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-5-[5-[3-[[(1-amino-2-methylpropan-2-yl)disulfanyl]methoxy]prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]-3-aminooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 166508204 |
| Molecular Formula | C17H29N4O15P3S2 |
| Molecular Weight | 686.49 g/mol |
| Exact Mass | 686.03 |
| IUPAC Name | [[(2R,5R)-5-[5-[3-[[(1-amino-2-methylpropan-2-yl)disulfanyl]methoxy]prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]-3-aminooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(C)(CN)SSCOCC#Cc1cn([C@H]2CC(ON)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H29N4O15P3S2/c1-17(2,9-18)41-40-10-31-5-3-4-11-7-21(16(23)20-15(11)22)14-6-12(34-19)13(33-14)8-32-38(27,28)36-39(29,30)35-37(24,25)26/h7,12-14H,5-6,8-10,18-19H2,1-2H3,(H,27,28)(H,29,30)(H,20,22,23)(H2,24,25,26)/t12?,13-,14-/m1/s1 |
| InChIKey | IRAJPNHMIHPQEL-ILMHWDKJSA-N |
| XLogP | -0.13 |
| TPSA | 294.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.49 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|