C15H19N2O14P3 — CID 88556995
[[(2R,5R)-5-(5-hexa-1,5-diynyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 88556995) has the molecular formula C15H19N2O14P3 and a molecular weight of 544.24 g/mol. Its IUPAC name is [[(2R,5R)-5-(5-hexa-1,5-diynyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-5-(5-hexa-1,5-diynyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 88556995 |
| Molecular Formula | C15H19N2O14P3 |
| Molecular Weight | 544.24 g/mol |
| Exact Mass | 544.00 |
| IUPAC Name | [[(2R,5R)-5-(5-hexa-1,5-diynyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#CCCC#Cc1cn([C@H]2CC(O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H19N2O14P3/c1-2-3-4-5-6-10-8-17(15(20)16-14(10)19)13-7-11(18)12(29-13)9-28-33(24,25)31-34(26,27)30-32(21,22)23/h1,8,11-13,18H,3-4,7,9H2,(H,24,25)(H,26,27)(H,16,19,20)(H2,21,22,23)/t11?,12-,13-/m1/s1 |
| InChIKey | VQWXBLUUEWJQQT-VFRRUGBOSA-N |
| XLogP | -0.71 |
| TPSA | 244.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.24 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|