C14H21N2O12P3 — CID 177295324
dimethylphosphoryl [[5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate (PubChem CID 177295324) has the molecular formula C14H21N2O12P3 and a molecular weight of 502.25 g/mol. Its IUPAC name is dimethylphosphoryl [[5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate.
| Compound Name | dimethylphosphoryl [[5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 177295324 |
| Molecular Formula | C14H21N2O12P3 |
| Molecular Weight | 502.25 g/mol |
| Exact Mass | 502.03 |
| IUPAC Name | dimethylphosphoryl [[5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate |
| SMILES | CC#Cc1cn(C2CC(O)C(COP(=O)(O)OP(=O)(O)OP(C)(C)=O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H21N2O12P3/c1-4-5-9-7-16(14(19)15-13(9)18)12-6-10(17)11(26-12)8-25-30(21,22)28-31(23,24)27-29(2,3)20/h7,10-12,17H,6,8H2,1-3H3,(H,21,22)(H,23,24)(H,15,18,19) |
| InChIKey | ALSBTRZCRZYJLV-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 203.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|