C17H27N3O11P2 — CID 10578106
[(2R,3S,5R)-5-[5-(8-aminooct-1-ynyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 10578106) has the molecular formula C17H27N3O11P2 and a molecular weight of 511.36 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[5-(8-aminooct-1-ynyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-[5-(8-aminooct-1-ynyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 10578106 |
| Molecular Formula | C17H27N3O11P2 |
| Molecular Weight | 511.36 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | [(2R,3S,5R)-5-[5-(8-aminooct-1-ynyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | NCCCCCCC#Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H27N3O11P2/c18-8-6-4-2-1-3-5-7-12-10-20(17(23)19-16(12)22)15-9-13(21)14(30-15)11-29-33(27,28)31-32(24,25)26/h10,13-15,21H,1-4,6,8-9,11,18H2,(H,27,28)(H,19,22,23)(H2,24,25,26)/t13-,14+,15+/m0/s1 |
| InChIKey | JZBHNOQBVMDDST-RRFJBIMHSA-N |
| XLogP | -0.33 |
| TPSA | 223.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.36 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|