C23H42N5O16P3 — CID 11216354
[[(2R,3S,5R)-5-[5-[2-[6-(6-aminohexanoylamino)hexylamino]-2-oxoethyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 11216354) has the molecular formula C23H42N5O16P3 and a molecular weight of 737.53 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-[5-[2-[6-(6-aminohexanoylamino)hexylamino]-2-oxoethyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-[5-[2-[6-(6-aminohexanoylamino)hexylamino]-2-oxoethyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 11216354 |
| Molecular Formula | C23H42N5O16P3 |
| Molecular Weight | 737.53 g/mol |
| Exact Mass | 737.18 |
| IUPAC Name | [[(2R,3S,5R)-5-[5-[2-[6-(6-aminohexanoylamino)hexylamino]-2-oxoethyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NCCCCCC(=O)NCCCCCCNC(=O)Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H42N5O16P3/c24-9-5-3-4-8-19(30)25-10-6-1-2-7-11-26-20(31)12-16-14-28(23(33)27-22(16)32)21-13-17(29)18(42-21)15-41-46(37,38)44-47(39,40)43-45(34,35)36/h14,17-18,21,29H,1-13,15,24H2,(H,25,30)(H,26,31)(H,37,38)(H,39,40)(H,27,32,33)(H2,34,35,36)/t17-,18+,21+/m0/s1 |
| InChIKey | KFZXNRZGSNKPGR-WAOWUJCRSA-N |
| XLogP | -0.62 |
| TPSA | 328.36 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.53 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|