C21H33N4O16P3 — CID 140673924
[hydroxy-[[(2R,3R,5R)-3-hydroxy-5-[5-[3-[[8-(methylamino)-8-oxooctanoyl]amino]prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate (PubChem CID 140673924) has the molecular formula C21H33N4O16P3 and a molecular weight of 690.43 g/mol. Its IUPAC name is [hydroxy-[[(2R,3R,5R)-3-hydroxy-5-[5-[3-[[8-(methylamino)-8-oxooctanoyl]amino]prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-[[(2R,3R,5R)-3-hydroxy-5-[5-[3-[[8-(methylamino)-8-oxooctanoyl]amino]prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 140673924 |
| Molecular Formula | C21H33N4O16P3 |
| Molecular Weight | 690.43 g/mol |
| Exact Mass | 690.11 |
| IUPAC Name | [hydroxy-[[(2R,3R,5R)-3-hydroxy-5-[5-[3-[[8-(methylamino)-8-oxooctanoyl]amino]prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
| SMILES | CNC(=O)CCCCCCC(=O)NCC#Cc1cn([C@H]2C[C@@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H33N4O16P3/c1-22-17(27)8-4-2-3-5-9-18(28)23-10-6-7-14-12-25(21(30)24-20(14)29)19-11-15(26)16(39-19)13-38-43(34,35)41-44(36,37)40-42(31,32)33/h12,15-16,19,26H,2-5,8-11,13H2,1H3,(H,22,27)(H,23,28)(H,34,35)(H,36,37)(H,24,29,30)(H2,31,32,33)/t15-,16-,19-/m1/s1 |
| InChIKey | FZIMNEAPZHJGGV-GPMSIDNRSA-N |
| XLogP | -0.92 |
| TPSA | 302.34 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.43 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|