C18H28BN2O15P3S4 — CID 174031339
CID 174031339 (PubChem CID 174031339) has the molecular formula C18H28BN2O15P3S4 and a molecular weight of 744.42 g/mol.
| Compound Name | CID 174031339 |
|---|---|
| PubChem CID | 174031339 |
| Molecular Formula | C18H28BN2O15P3S4 |
| Molecular Weight | 744.42 g/mol |
| Exact Mass | 743.97 |
| IUPAC Name | — |
| SMILES | [B]SSCOCC#Cc1cn([C@H]2C[C@@H](OCSSC(C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H28BN2O15P3S4/c1-18(2,3)42-40-11-32-13-7-15(21-8-12(16(22)20-17(21)23)5-4-6-31-10-41-43-19)34-14(13)9-33-38(27,28)36-39(29,30)35-37(24,25)26/h8,13-15H,6-7,9-11H2,1-3H3,(H,27,28)(H,29,30)(H,20,22,23)(H2,24,25,26)/t13-,14?,15-/m1/s1 |
| InChIKey | PZCKXMYWMGZECE-GIJJTGMTSA-N |
| XLogP | 2.48 |
| TPSA | 242.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|