C11H18N5O14P3 — CID 129190829
[[(3R,5R)-3-(azidomethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 129190829) has the molecular formula C11H18N5O14P3 and a molecular weight of 537.21 g/mol. Its IUPAC name is [[(3R,5R)-3-(azidomethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(3R,5R)-3-(azidomethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 129190829 |
| Molecular Formula | C11H18N5O14P3 |
| Molecular Weight | 537.21 g/mol |
| Exact Mass | 537.01 |
| IUPAC Name | [[(3R,5R)-3-(azidomethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1cn([C@H]2C[C@@H](OCN=[N+]=[N-])C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H18N5O14P3/c1-6-3-16(11(18)14-10(6)17)9-2-7(26-5-13-15-12)8(28-9)4-27-32(22,23)30-33(24,25)29-31(19,20)21/h3,7-9H,2,4-5H2,1H3,(H,22,23)(H,24,25)(H,14,17,18)(H2,19,20,21)/t7-,8?,9-/m1/s1 |
| InChIKey | NLCMYGVMMMRQPV-PSGOWDBMSA-N |
| XLogP | 0.13 |
| TPSA | 281.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|