C13H19N8O13P3 — CID 53389039
[[(2S,3S,5R)-3-[5-(azidomethyl)triazol-1-yl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 53389039) has the molecular formula C13H19N8O13P3 and a molecular weight of 588.26 g/mol. Its IUPAC name is [[(2S,3S,5R)-3-[5-(azidomethyl)triazol-1-yl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3S,5R)-3-[5-(azidomethyl)triazol-1-yl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 53389039 |
| Molecular Formula | C13H19N8O13P3 |
| Molecular Weight | 588.26 g/mol |
| Exact Mass | 588.03 |
| IUPAC Name | [[(2S,3S,5R)-3-[5-(azidomethyl)triazol-1-yl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1cn([C@H]2C[C@H](n3nncc3CN=[N+]=[N-])[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H19N8O13P3/c1-7-5-20(13(23)17-12(7)22)11-2-9(21-8(3-15-18-14)4-16-19-21)10(32-11)6-31-36(27,28)34-37(29,30)33-35(24,25)26/h4-5,9-11H,2-3,6H2,1H3,(H,27,28)(H,29,30)(H,17,22,23)(H2,24,25,26)/t9-,10+,11+/m0/s1 |
| InChIKey | QYMGBVHELXUZAV-HBNTYKKESA-N |
| XLogP | 0.12 |
| TPSA | 303.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.26 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|