C14H22N5O14P3 — CID 174047008
[[(2R,5R)-3-[azido(cyclopropyl)methoxy]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 174047008) has the molecular formula C14H22N5O14P3 and a molecular weight of 577.27 g/mol. Its IUPAC name is [[(2R,5R)-3-[azido(cyclopropyl)methoxy]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-3-[azido(cyclopropyl)methoxy]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174047008 |
| Molecular Formula | C14H22N5O14P3 |
| Molecular Weight | 577.27 g/mol |
| Exact Mass | 577.04 |
| IUPAC Name | [[(2R,5R)-3-[azido(cyclopropyl)methoxy]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1cn([C@H]2CC(OC(N=[N+]=[N-])C3CC3)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H22N5O14P3/c1-7-5-19(14(21)16-12(7)20)11-4-9(31-13(17-18-15)8-2-3-8)10(30-11)6-29-35(25,26)33-36(27,28)32-34(22,23)24/h5,8-11,13H,2-4,6H2,1H3,(H,25,26)(H,27,28)(H,16,20,21)(H2,22,23,24)/t9?,10-,11-,13?/m1/s1 |
| InChIKey | LVTHXPIZGDATAQ-QRVCZOOMSA-N |
| XLogP | 0.91 |
| TPSA | 281.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|