C18H23N6O15P3 — CID 170937036
[(2R,5R)-2-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 2-(1-azidoethyl)pyridine-3-carboxylate (PubChem CID 170937036) has the molecular formula C18H23N6O15P3 and a molecular weight of 656.33 g/mol. Its IUPAC name is [(2R,5R)-2-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 2-(1-azidoethyl)pyridine-3-carboxylate.
| Compound Name | [(2R,5R)-2-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 2-(1-azidoethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 170937036 |
| Molecular Formula | C18H23N6O15P3 |
| Molecular Weight | 656.33 g/mol |
| Exact Mass | 656.04 |
| IUPAC Name | [(2R,5R)-2-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 2-(1-azidoethyl)pyridine-3-carboxylate |
| SMILES | Cc1cn([C@H]2CC(OC(=O)c3cccnc3C(C)N=[N+]=[N-])[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H23N6O15P3/c1-9-7-24(18(27)21-16(9)25)14-6-12(37-17(26)11-4-3-5-20-15(11)10(2)22-23-19)13(36-14)8-35-41(31,32)39-42(33,34)38-40(28,29)30/h3-5,7,10,12-14H,6,8H2,1-2H3,(H,31,32)(H,33,34)(H,21,25,27)(H2,28,29,30)/t10?,12?,13-,14-/m1/s1 |
| InChIKey | GILIQTWJLGILDF-CCAROEGRSA-N |
| XLogP | 1.47 |
| TPSA | 311.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|