C15H18ClN5O5 — CID 14606817
[(2S,3S,5R)-3-[5-(chloromethyl)triazol-1-yl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 14606817) has the molecular formula C15H18ClN5O5 and a molecular weight of 383.79 g/mol. Its IUPAC name is [(2S,3S,5R)-3-[5-(chloromethyl)triazol-1-yl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,5R)-3-[5-(chloromethyl)triazol-1-yl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14606817 |
| Molecular Formula | C15H18ClN5O5 |
| Molecular Weight | 383.79 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | [(2S,3S,5R)-3-[5-(chloromethyl)triazol-1-yl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1n1nncc1CCl |
| InChI | InChI=1S/C15H18ClN5O5/c1-8-6-20(15(24)18-14(8)23)13-3-11(12(26-13)7-25-9(2)22)21-10(4-16)5-17-19-21/h5-6,11-13H,3-4,7H2,1-2H3,(H,18,23,24)/t11-,12+,13+/m0/s1 |
| InChIKey | MNNHTJVUOIHDEN-YNEHKIRRSA-N |
| XLogP | 0.27 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.79 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|