C11H15N5O14P3-3 — CID 148646766
[[[(2R,3R,5R)-3-(azidomethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate (PubChem CID 148646766) has the molecular formula C11H15N5O14P3-3 and a molecular weight of 534.18 g/mol. Its IUPAC name is [[[(2R,3R,5R)-3-(azidomethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate.
| Compound Name | [[[(2R,3R,5R)-3-(azidomethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 148646766 |
| Molecular Formula | C11H15N5O14P3-3 |
| Molecular Weight | 534.18 g/mol |
| Exact Mass | 533.98 |
| IUPAC Name | [[[(2R,3R,5R)-3-(azidomethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate |
| SMILES | Cc1cn([C@H]2C[C@@H](OCN=[N+]=[N-])[C@@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H18N5O14P3/c1-6-3-16(11(18)14-10(6)17)9-2-7(26-5-13-15-12)8(28-9)4-27-32(22,23)30-33(24,25)29-31(19,20)21/h3,7-9H,2,4-5H2,1H3,(H,22,23)(H,24,25)(H,14,17,18)(H2,19,20,21)/p-3/t7-,8-,9-/m1/s1 |
| InChIKey | NLCMYGVMMMRQPV-IWSPIJDZSA-K |
| XLogP | -1.77 |
| TPSA | 290.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.18 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|