C12H17N6O14P3 — CID 176808443
[(2S,3S,5S)-5-[5-(3-aminoprop-1-ynyl)-2,4-dioxopyrimidin-1-yl]-3-(azidomethoxy)oxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 176808443) has the molecular formula C12H17N6O14P3 and a molecular weight of 562.22 g/mol. Its IUPAC name is [(2S,3S,5S)-5-[5-(3-aminoprop-1-ynyl)-2,4-dioxopyrimidin-1-yl]-3-(azidomethoxy)oxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | [(2S,3S,5S)-5-[5-(3-aminoprop-1-ynyl)-2,4-dioxopyrimidin-1-yl]-3-(azidomethoxy)oxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 176808443 |
| Molecular Formula | C12H17N6O14P3 |
| Molecular Weight | 562.22 g/mol |
| Exact Mass | 562.00 |
| IUPAC Name | [(2S,3S,5S)-5-[5-(3-aminoprop-1-ynyl)-2,4-dioxopyrimidin-1-yl]-3-(azidomethoxy)oxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | [N-]=[N+]=NCO[C@H]1C[C@@H](n2cc(C#CCN)c(=O)[nH]c2=O)O[C@H]1OP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C12H17N6O14P3/c13-3-1-2-7-5-18(12(20)16-10(7)19)9-4-8(28-6-15-17-14)11(29-9)30-34(24,25)32-35(26,27)31-33(21,22)23/h5,8-9,11H,3-4,6,13H2,(H,24,25)(H,26,27)(H,16,19,20)(H2,21,22,23)/t8-,9-,11-/m0/s1 |
| InChIKey | RJTRBZHIVJTLSW-QXEWZRGKSA-N |
| XLogP | -0.91 |
| TPSA | 307.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.22 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|