C11H14N3O8P — CID 68503087
[5-[5-(3-aminoprop-1-ynyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl] dihydrogen phosphate (PubChem CID 68503087) has the molecular formula C11H14N3O8P and a molecular weight of 347.22 g/mol. Its IUPAC name is [5-[5-(3-aminoprop-1-ynyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl] dihydrogen phosphate.
| Compound Name | [5-[5-(3-aminoprop-1-ynyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 68503087 |
| Molecular Formula | C11H14N3O8P |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | [5-[5-(3-aminoprop-1-ynyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl] dihydrogen phosphate |
| SMILES | NCC#Cc1cn(C2CC(O)C(OP(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H14N3O8P/c12-3-1-2-6-5-14(11(17)13-9(6)16)8-4-7(15)10(21-8)22-23(18,19)20/h5,7-8,10,15H,3-4,12H2,(H,13,16,17)(H2,18,19,20) |
| InChIKey | DSCHXJCRHAMCPL-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 177.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|